C19H14Cl2O6 — CID 5154223
(7-methoxy-2-oxochromen-4-yl)methyl 2-(2,4-dichlorophenoxy)acetate (PubChem CID 5154223) has the molecular formula C19H14Cl2O6 and a molecular weight of 409.22 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 5154223 |
| Molecular Formula | C19H14Cl2O6 |
| Molecular Weight | 409.22 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl 2-(2,4-dichlorophenoxy)acetate |
| SMILES | COc1ccc2c(COC(=O)COc3ccc(Cl)cc3Cl)cc(=O)oc2c1 |
| InChI | InChI=1S/C19H14Cl2O6/c1-24-13-3-4-14-11(6-18(22)27-17(14)8-13)9-26-19(23)10-25-16-5-2-12(20)7-15(16)21/h2-8H,9-10H2,1H3 |
| InChIKey | OVXGFNRYSFIQFR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.22 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|