C19H14Cl2O5 — CID 7925899
(4-ethyl-2-oxochromen-7-yl) 2-(2,4-dichlorophenoxy)acetate (PubChem CID 7925899) has the molecular formula C19H14Cl2O5 and a molecular weight of 393.22 g/mol. Its IUPAC name is (4-ethyl-2-oxochromen-7-yl) 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | (4-ethyl-2-oxochromen-7-yl) 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 7925899 |
| Molecular Formula | C19H14Cl2O5 |
| Molecular Weight | 393.22 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | (4-ethyl-2-oxochromen-7-yl) 2-(2,4-dichlorophenoxy)acetate |
| SMILES | CCc1cc(=O)oc2cc(OC(=O)COc3ccc(Cl)cc3Cl)ccc12 |
| InChI | InChI=1S/C19H14Cl2O5/c1-2-11-7-18(22)26-17-9-13(4-5-14(11)17)25-19(23)10-24-16-6-3-12(20)8-15(16)21/h3-9H,2,10H2,1H3 |
| InChIKey | KNLUQQALMZQSMY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.22 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|