C18H12Cl2O4 — CID 7925911
(4-ethyl-2-oxochromen-7-yl) 3,4-dichlorobenzoate (PubChem CID 7925911) has the molecular formula C18H12Cl2O4 and a molecular weight of 363.20 g/mol. Its IUPAC name is (4-ethyl-2-oxochromen-7-yl) 3,4-dichlorobenzoate.
| Compound Name | (4-ethyl-2-oxochromen-7-yl) 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 7925911 |
| Molecular Formula | C18H12Cl2O4 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | (4-ethyl-2-oxochromen-7-yl) 3,4-dichlorobenzoate |
| SMILES | CCc1cc(=O)oc2cc(OC(=O)c3ccc(Cl)c(Cl)c3)ccc12 |
| InChI | InChI=1S/C18H12Cl2O4/c1-2-10-8-17(21)24-16-9-12(4-5-13(10)16)23-18(22)11-3-6-14(19)15(20)7-11/h3-9H,2H2,1H3 |
| InChIKey | KQAXXVLACUJRLG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|