C18H12F2O4 — CID 8879773
(4-ethyl-2-oxochromen-7-yl) 3,5-difluorobenzoate (PubChem CID 8879773) has the molecular formula C18H12F2O4 and a molecular weight of 330.29 g/mol. Its IUPAC name is (4-ethyl-2-oxochromen-7-yl) 3,5-difluorobenzoate.
| Compound Name | (4-ethyl-2-oxochromen-7-yl) 3,5-difluorobenzoate |
|---|---|
| PubChem CID | 8879773 |
| Molecular Formula | C18H12F2O4 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | (4-ethyl-2-oxochromen-7-yl) 3,5-difluorobenzoate |
| SMILES | CCc1cc(=O)oc2cc(OC(=O)c3cc(F)cc(F)c3)ccc12 |
| InChI | InChI=1S/C18H12F2O4/c1-2-10-7-17(21)24-16-9-14(3-4-15(10)16)23-18(22)11-5-12(19)8-13(20)6-11/h3-9H,2H2,1H3 |
| InChIKey | AEUSWKMFIPBIKQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|