C18H13Cl2NO4 — CID 7750795
(2-oxo-4-propylchromen-7-yl) 5,6-dichloropyridine-3-carboxylate (PubChem CID 7750795) has the molecular formula C18H13Cl2NO4 and a molecular weight of 378.21 g/mol. Its IUPAC name is (2-oxo-4-propylchromen-7-yl) 5,6-dichloropyridine-3-carboxylate.
| Compound Name | (2-oxo-4-propylchromen-7-yl) 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 7750795 |
| Molecular Formula | C18H13Cl2NO4 |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | (2-oxo-4-propylchromen-7-yl) 5,6-dichloropyridine-3-carboxylate |
| SMILES | CCCc1cc(=O)oc2cc(OC(=O)c3cnc(Cl)c(Cl)c3)ccc12 |
| InChI | InChI=1S/C18H13Cl2NO4/c1-2-3-10-7-16(22)25-15-8-12(4-5-13(10)15)24-18(23)11-6-14(19)17(20)21-9-11/h4-9H,2-3H2,1H3 |
| InChIKey | ORNKJPZBLXPCLP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|