C20H16Cl2O4 — CID 23827898
7-[2-(2,4-dichlorophenyl)-2-oxoethoxy]-4-propylchromen-2-one (PubChem CID 23827898) has the molecular formula C20H16Cl2O4 and a molecular weight of 391.25 g/mol. Its IUPAC name is 7-[2-(2,4-dichlorophenyl)-2-oxoethoxy]-4-propylchromen-2-one.
| Compound Name | 7-[2-(2,4-dichlorophenyl)-2-oxoethoxy]-4-propylchromen-2-one |
|---|---|
| PubChem CID | 23827898 |
| Molecular Formula | C20H16Cl2O4 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 7-[2-(2,4-dichlorophenyl)-2-oxoethoxy]-4-propylchromen-2-one |
| SMILES | CCCc1cc(=O)oc2cc(OCC(=O)c3ccc(Cl)cc3Cl)ccc12 |
| InChI | InChI=1S/C20H16Cl2O4/c1-2-3-12-8-20(24)26-19-10-14(5-7-15(12)19)25-11-18(23)16-6-4-13(21)9-17(16)22/h4-10H,2-3,11H2,1H3 |
| InChIKey | DOGVXAYJZQTSMQ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|