C21H27NO4 — CID 42967629
7-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-4-propylchromen-2-one (PubChem CID 42967629) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is 7-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-4-propylchromen-2-one.
| Compound Name | 7-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-4-propylchromen-2-one |
|---|---|
| PubChem CID | 42967629 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 7-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-4-propylchromen-2-one |
| SMILES | CCCc1cc(=O)oc2cc(OCC(=O)N3C(C)CCCC3C)ccc12 |
| InChI | InChI=1S/C21H27NO4/c1-4-6-16-11-21(24)26-19-12-17(9-10-18(16)19)25-13-20(23)22-14(2)7-5-8-15(22)3/h9-12,14-15H,4-8,13H2,1-3H3 |
| InChIKey | CSWXLXWNOWGFQE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|