C24H24N2O6 — CID 112786090
7-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-4-(4-nitrophenyl)chromen-2-one (PubChem CID 112786090) has the molecular formula C24H24N2O6 and a molecular weight of 436.46 g/mol. Its IUPAC name is 7-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-4-(4-nitrophenyl)chromen-2-one.
| Compound Name | 7-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-4-(4-nitrophenyl)chromen-2-one |
|---|---|
| PubChem CID | 112786090 |
| Molecular Formula | C24H24N2O6 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 7-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-4-(4-nitrophenyl)chromen-2-one |
| SMILES | CC1CCCC(C)N1C(=O)COc1ccc2c(-c3ccc([N+](=O)[O-])cc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H24N2O6/c1-15-4-3-5-16(2)25(15)23(27)14-31-19-10-11-20-21(13-24(28)32-22(20)12-19)17-6-8-18(9-7-17)26(29)30/h6-13,15-16H,3-5,14H2,1-2H3 |
| InChIKey | VBTNCEQJTBKUAQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 102.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|