C27H20ClN3O7 — CID 25155511
N-[3-chloro-2-(4-nitrophenyl)-5-oxopyrrolidin-1-yl]-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide (PubChem CID 25155511) has the molecular formula C27H20ClN3O7 and a molecular weight of 533.92 g/mol. Its IUPAC name is N-[3-chloro-2-(4-nitrophenyl)-5-oxopyrrolidin-1-yl]-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide.
| Compound Name | N-[3-chloro-2-(4-nitrophenyl)-5-oxopyrrolidin-1-yl]-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 25155511 |
| Molecular Formula | C27H20ClN3O7 |
| Molecular Weight | 533.92 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | N-[3-chloro-2-(4-nitrophenyl)-5-oxopyrrolidin-1-yl]-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide |
| SMILES | O=C(COc1ccc2c(-c3ccccc3)cc(=O)oc2c1)NN1C(=O)CC(Cl)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H20ClN3O7/c28-22-14-25(33)30(27(22)17-6-8-18(9-7-17)31(35)36)29-24(32)15-37-19-10-11-20-21(16-4-2-1-3-5-16)13-26(34)38-23(20)12-19/h1-13,22,27H,14-15H2,(H,29,32) |
| InChIKey | PMXYFGQXGNUGLR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 131.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.92 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|