C21H19NO7S — CID 40816162
N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide (PubChem CID 40816162) has the molecular formula C21H19NO7S and a molecular weight of 429.45 g/mol. Its IUPAC name is N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide.
| Compound Name | N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 40816162 |
| Molecular Formula | C21H19NO7S |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide |
| SMILES | O=C(COc1ccc2c(-c3ccccc3)cc(=O)oc2c1)N[C@@H]1CS(=O)(=O)C[C@H]1O |
| InChI | InChI=1S/C21H19NO7S/c23-18-12-30(26,27)11-17(18)22-20(24)10-28-14-6-7-15-16(13-4-2-1-3-5-13)9-21(25)29-19(15)8-14/h1-9,17-18,23H,10-12H2,(H,22,24)/t17-,18-/m1/s1 |
| InChIKey | QYEJYNLGGVATQN-QZTJIDSGSA-N |
| XLogP | 1.11 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|