C22H21NO6S — CID 41069073
N-[(3S)-1,1-dioxothiolan-3-yl]-N-methyl-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide (PubChem CID 41069073) has the molecular formula C22H21NO6S and a molecular weight of 427.48 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-N-methyl-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-methyl-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 41069073 |
| Molecular Formula | C22H21NO6S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-methyl-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide |
| SMILES | CN(C(=O)COc1ccc2c(-c3ccccc3)cc(=O)oc2c1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H21NO6S/c1-23(16-9-10-30(26,27)14-16)21(24)13-28-17-7-8-18-19(15-5-3-2-4-6-15)12-22(25)29-20(18)11-17/h2-8,11-12,16H,9-10,13-14H2,1H3/t16-/m0/s1 |
| InChIKey | MWHNAALZJOOLDY-INIZCTEOSA-N |
| XLogP | 2.48 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|