C24H24ClNO6S — CID 24578321
2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(1,1-dioxothiolan-3-yl)-N-propylacetamide (PubChem CID 24578321) has the molecular formula C24H24ClNO6S and a molecular weight of 489.98 g/mol. Its IUPAC name is 2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(1,1-dioxothiolan-3-yl)-N-propylacetamide.
| Compound Name | 2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(1,1-dioxothiolan-3-yl)-N-propylacetamide |
|---|---|
| PubChem CID | 24578321 |
| Molecular Formula | C24H24ClNO6S |
| Molecular Weight | 489.98 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | 2-(6-chloro-2-oxo-4-phenylchromen-7-yl)oxy-N-(1,1-dioxothiolan-3-yl)-N-propylacetamide |
| SMILES | CCCN(C(=O)COc1cc2oc(=O)cc(-c3ccccc3)c2cc1Cl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C24H24ClNO6S/c1-2-9-26(17-8-10-33(29,30)15-17)23(27)14-31-22-13-21-19(11-20(22)25)18(12-24(28)32-21)16-6-4-3-5-7-16/h3-7,11-13,17H,2,8-10,14-15H2,1H3 |
| InChIKey | GNYXASLUBYAGBJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.98 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|