C19H23NO6S — CID 7643711
N-[(3S)-1,1-dioxothiolan-3-yl]-N-methyl-2-(2-oxo-4-propylchromen-7-yl)oxyacetamide (PubChem CID 7643711) has the molecular formula C19H23NO6S and a molecular weight of 393.46 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-N-methyl-2-(2-oxo-4-propylchromen-7-yl)oxyacetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-methyl-2-(2-oxo-4-propylchromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 7643711 |
| Molecular Formula | C19H23NO6S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-methyl-2-(2-oxo-4-propylchromen-7-yl)oxyacetamide |
| SMILES | CCCc1cc(=O)oc2cc(OCC(=O)N(C)[C@H]3CCS(=O)(=O)C3)ccc12 |
| InChI | InChI=1S/C19H23NO6S/c1-3-4-13-9-19(22)26-17-10-15(5-6-16(13)17)25-11-18(21)20(2)14-7-8-27(23,24)12-14/h5-6,9-10,14H,3-4,7-8,11-12H2,1-2H3/t14-/m0/s1 |
| InChIKey | DZDBVNWNTAMHDO-AWEZNQCLSA-N |
| XLogP | 1.77 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|