C18H12Cl2O5 — CID 8778362
(2,4-dichlorophenyl) 2-(4-methyl-2-oxochromen-7-yl)oxyacetate (PubChem CID 8778362) has the molecular formula C18H12Cl2O5 and a molecular weight of 379.20 g/mol. Its IUPAC name is (2,4-dichlorophenyl) 2-(4-methyl-2-oxochromen-7-yl)oxyacetate.
| Compound Name | (2,4-dichlorophenyl) 2-(4-methyl-2-oxochromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 8778362 |
| Molecular Formula | C18H12Cl2O5 |
| Molecular Weight | 379.20 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | (2,4-dichlorophenyl) 2-(4-methyl-2-oxochromen-7-yl)oxyacetate |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)Oc3ccc(Cl)cc3Cl)ccc12 |
| InChI | InChI=1S/C18H12Cl2O5/c1-10-6-17(21)25-16-8-12(3-4-13(10)16)23-9-18(22)24-15-5-2-11(19)7-14(15)20/h2-8H,9H2,1H3 |
| InChIKey | NMLMWBXOEJWZNA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.20 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|