C20H17ClO5 — CID 7917090
(4,8-dimethyl-2-oxochromen-7-yl) 2-(4-chloro-3-methylphenoxy)acetate (PubChem CID 7917090) has the molecular formula C20H17ClO5 and a molecular weight of 372.80 g/mol. Its IUPAC name is (4,8-dimethyl-2-oxochromen-7-yl) 2-(4-chloro-3-methylphenoxy)acetate.
| Compound Name | (4,8-dimethyl-2-oxochromen-7-yl) 2-(4-chloro-3-methylphenoxy)acetate |
|---|---|
| PubChem CID | 7917090 |
| Molecular Formula | C20H17ClO5 |
| Molecular Weight | 372.80 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | (4,8-dimethyl-2-oxochromen-7-yl) 2-(4-chloro-3-methylphenoxy)acetate |
| SMILES | Cc1cc(OCC(=O)Oc2ccc3c(C)cc(=O)oc3c2C)ccc1Cl |
| InChI | InChI=1S/C20H17ClO5/c1-11-9-18(22)26-20-13(3)17(7-5-15(11)20)25-19(23)10-24-14-4-6-16(21)12(2)8-14/h4-9H,10H2,1-3H3 |
| InChIKey | MTHBCMKQJZCXMJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.80 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|