C20H18O5 — CID 974991
benzyl 2-(4,8-dimethyl-2-oxochromen-7-yl)oxyacetate (PubChem CID 974991) has the molecular formula C20H18O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is benzyl 2-(4,8-dimethyl-2-oxochromen-7-yl)oxyacetate.
| Compound Name | benzyl 2-(4,8-dimethyl-2-oxochromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 974991 |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | benzyl 2-(4,8-dimethyl-2-oxochromen-7-yl)oxyacetate |
| SMILES | Cc1cc(=O)oc2c(C)c(OCC(=O)OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C20H18O5/c1-13-10-18(21)25-20-14(2)17(9-8-16(13)20)23-12-19(22)24-11-15-6-4-3-5-7-15/h3-10H,11-12H2,1-2H3 |
| InChIKey | FZWCTTUGDBJCQV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|