C23H23NO5 — CID 8563690
2-(4,8-dimethyl-2-oxochromen-7-yl)oxy-N-[(2S)-3-oxo-1-phenylbutan-2-yl]acetamide (PubChem CID 8563690) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-(4,8-dimethyl-2-oxochromen-7-yl)oxy-N-[(2S)-3-oxo-1-phenylbutan-2-yl]acetamide.
| Compound Name | 2-(4,8-dimethyl-2-oxochromen-7-yl)oxy-N-[(2S)-3-oxo-1-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 8563690 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 2-(4,8-dimethyl-2-oxochromen-7-yl)oxy-N-[(2S)-3-oxo-1-phenylbutan-2-yl]acetamide |
| SMILES | CC(=O)[C@H](Cc1ccccc1)NC(=O)COc1ccc2c(C)cc(=O)oc2c1C |
| InChI | InChI=1S/C23H23NO5/c1-14-11-22(27)29-23-15(2)20(10-9-18(14)23)28-13-21(26)24-19(16(3)25)12-17-7-5-4-6-8-17/h4-11,19H,12-13H2,1-3H3,(H,24,26)/t19-/m0/s1 |
| InChIKey | QGJJXZDRKXXIHI-IBGZPJMESA-N |
| XLogP | 3.11 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|