C18H22N2O5 — CID 8563687
2-(4,8-dimethyl-2-oxochromen-7-yl)oxy-N-(2-methylpropylcarbamoyl)acetamide (PubChem CID 8563687) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is 2-(4,8-dimethyl-2-oxochromen-7-yl)oxy-N-(2-methylpropylcarbamoyl)acetamide.
| Compound Name | 2-(4,8-dimethyl-2-oxochromen-7-yl)oxy-N-(2-methylpropylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 8563687 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 2-(4,8-dimethyl-2-oxochromen-7-yl)oxy-N-(2-methylpropylcarbamoyl)acetamide |
| SMILES | Cc1cc(=O)oc2c(C)c(OCC(=O)NC(=O)NCC(C)C)ccc12 |
| InChI | InChI=1S/C18H22N2O5/c1-10(2)8-19-18(23)20-15(21)9-24-14-6-5-13-11(3)7-16(22)25-17(13)12(14)4/h5-7,10H,8-9H2,1-4H3,(H2,19,20,21,23) |
| InChIKey | UFMAPBAQLFJOSX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|