C21H26N2O5 — CID 8563832
2-(4,8-dimethyl-2-oxochromen-7-yl)oxy-N-[[(1R,2S)-2-methylcyclohexyl]carbamoyl]acetamide (PubChem CID 8563832) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is 2-(4,8-dimethyl-2-oxochromen-7-yl)oxy-N-[[(1R,2S)-2-methylcyclohexyl]carbamoyl]acetamide.
| Compound Name | 2-(4,8-dimethyl-2-oxochromen-7-yl)oxy-N-[[(1R,2S)-2-methylcyclohexyl]carbamoyl]acetamide |
|---|---|
| PubChem CID | 8563832 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 2-(4,8-dimethyl-2-oxochromen-7-yl)oxy-N-[[(1R,2S)-2-methylcyclohexyl]carbamoyl]acetamide |
| SMILES | Cc1cc(=O)oc2c(C)c(OCC(=O)NC(=O)N[C@@H]3CCCC[C@@H]3C)ccc12 |
| InChI | InChI=1S/C21H26N2O5/c1-12-6-4-5-7-16(12)22-21(26)23-18(24)11-27-17-9-8-15-13(2)10-19(25)28-20(15)14(17)3/h8-10,12,16H,4-7,11H2,1-3H3,(H2,22,23,24,26)/t12-,16+/m0/s1 |
| InChIKey | FHZYJWZNPJMYKX-BLLLJJGKSA-N |
| XLogP | 3.19 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|