C18H24N2O5 — CID 8634198
2-(2-formyl-4-methoxyphenoxy)-N-[[(1S,2R)-2-methylcyclohexyl]carbamoyl]acetamide (PubChem CID 8634198) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-(2-formyl-4-methoxyphenoxy)-N-[[(1S,2R)-2-methylcyclohexyl]carbamoyl]acetamide.
| Compound Name | 2-(2-formyl-4-methoxyphenoxy)-N-[[(1S,2R)-2-methylcyclohexyl]carbamoyl]acetamide |
|---|---|
| PubChem CID | 8634198 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-(2-formyl-4-methoxyphenoxy)-N-[[(1S,2R)-2-methylcyclohexyl]carbamoyl]acetamide |
| SMILES | COc1ccc(OCC(=O)NC(=O)N[C@H]2CCCC[C@H]2C)c(C=O)c1 |
| InChI | InChI=1S/C18H24N2O5/c1-12-5-3-4-6-15(12)19-18(23)20-17(22)11-25-16-8-7-14(24-2)9-13(16)10-21/h7-10,12,15H,3-6,11H2,1-2H3,(H2,19,20,22,23)/t12-,15+/m1/s1 |
| InChIKey | MXFRQTJUBQDBTH-DOMZBBRYSA-N |
| XLogP | 2.29 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|