C16H20BrNO3 — CID 7819987
2-(4-bromo-2-formylphenoxy)-N-[(1R,2S)-2-methylcyclohexyl]acetamide (PubChem CID 7819987) has the molecular formula C16H20BrNO3 and a molecular weight of 354.24 g/mol. Its IUPAC name is 2-(4-bromo-2-formylphenoxy)-N-[(1R,2S)-2-methylcyclohexyl]acetamide.
| Compound Name | 2-(4-bromo-2-formylphenoxy)-N-[(1R,2S)-2-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 7819987 |
| Molecular Formula | C16H20BrNO3 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 2-(4-bromo-2-formylphenoxy)-N-[(1R,2S)-2-methylcyclohexyl]acetamide |
| SMILES | C[C@H]1CCCC[C@H]1NC(=O)COc1ccc(Br)cc1C=O |
| InChI | InChI=1S/C16H20BrNO3/c1-11-4-2-3-5-14(11)18-16(20)10-21-15-7-6-13(17)8-12(15)9-19/h6-9,11,14H,2-5,10H2,1H3,(H,18,20)/t11-,14+/m0/s1 |
| InChIKey | JJFFOFCZBOPDFC-SMDDNHRTSA-N |
| XLogP | 3.34 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|