C15H18BrNO4 — CID 7568980
2-(4-bromo-5-formyl-2-methoxyphenoxy)-N-cyclopentylacetamide (PubChem CID 7568980) has the molecular formula C15H18BrNO4 and a molecular weight of 356.22 g/mol. Its IUPAC name is 2-(4-bromo-5-formyl-2-methoxyphenoxy)-N-cyclopentylacetamide.
| Compound Name | 2-(4-bromo-5-formyl-2-methoxyphenoxy)-N-cyclopentylacetamide |
|---|---|
| PubChem CID | 7568980 |
| Molecular Formula | C15H18BrNO4 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 2-(4-bromo-5-formyl-2-methoxyphenoxy)-N-cyclopentylacetamide |
| SMILES | COc1cc(Br)c(C=O)cc1OCC(=O)NC1CCCC1 |
| InChI | InChI=1S/C15H18BrNO4/c1-20-13-7-12(16)10(8-18)6-14(13)21-9-15(19)17-11-4-2-3-5-11/h6-8,11H,2-5,9H2,1H3,(H,17,19) |
| InChIKey | JSYQSBGZRPMZEN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|