C17H24BrNO4 — CID 8582263
2-(4-bromo-5-formyl-2-methoxyphenoxy)-N-[(2S)-5-methylhexan-2-yl]acetamide (PubChem CID 8582263) has the molecular formula C17H24BrNO4 and a molecular weight of 386.29 g/mol. Its IUPAC name is 2-(4-bromo-5-formyl-2-methoxyphenoxy)-N-[(2S)-5-methylhexan-2-yl]acetamide.
| Compound Name | 2-(4-bromo-5-formyl-2-methoxyphenoxy)-N-[(2S)-5-methylhexan-2-yl]acetamide |
|---|---|
| PubChem CID | 8582263 |
| Molecular Formula | C17H24BrNO4 |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 2-(4-bromo-5-formyl-2-methoxyphenoxy)-N-[(2S)-5-methylhexan-2-yl]acetamide |
| SMILES | COc1cc(Br)c(C=O)cc1OCC(=O)N[C@@H](C)CCC(C)C |
| InChI | InChI=1S/C17H24BrNO4/c1-11(2)5-6-12(3)19-17(21)10-23-16-7-13(9-20)14(18)8-15(16)22-4/h7-9,11-12H,5-6,10H2,1-4H3,(H,19,21)/t12-/m0/s1 |
| InChIKey | BGZRHVUVRNJMSK-LBPRGKRZSA-N |
| XLogP | 3.59 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|