C11H12BrNO4 — CID 7568725
2-(4-bromo-5-formyl-2-methoxyphenoxy)-N-methylacetamide (PubChem CID 7568725) has the molecular formula C11H12BrNO4 and a molecular weight of 302.12 g/mol. Its IUPAC name is 2-(4-bromo-5-formyl-2-methoxyphenoxy)-N-methylacetamide.
| Compound Name | 2-(4-bromo-5-formyl-2-methoxyphenoxy)-N-methylacetamide |
|---|---|
| PubChem CID | 7568725 |
| Molecular Formula | C11H12BrNO4 |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 2-(4-bromo-5-formyl-2-methoxyphenoxy)-N-methylacetamide |
| SMILES | CNC(=O)COc1cc(C=O)c(Br)cc1OC |
| InChI | InChI=1S/C11H12BrNO4/c1-13-11(15)6-17-10-3-7(5-14)8(12)4-9(10)16-2/h3-5H,6H2,1-2H3,(H,13,15) |
| InChIKey | SITNWCJWOLMFHC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|