C18H27NO4 — CID 8808315
2-(4-acetyl-2-methoxyphenoxy)-N-[(2S)-5-methylhexan-2-yl]acetamide (PubChem CID 8808315) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-(4-acetyl-2-methoxyphenoxy)-N-[(2S)-5-methylhexan-2-yl]acetamide.
| Compound Name | 2-(4-acetyl-2-methoxyphenoxy)-N-[(2S)-5-methylhexan-2-yl]acetamide |
|---|---|
| PubChem CID | 8808315 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 2-(4-acetyl-2-methoxyphenoxy)-N-[(2S)-5-methylhexan-2-yl]acetamide |
| SMILES | COc1cc(C(C)=O)ccc1OCC(=O)N[C@@H](C)CCC(C)C |
| InChI | InChI=1S/C18H27NO4/c1-12(2)6-7-13(3)19-18(21)11-23-16-9-8-15(14(4)20)10-17(16)22-5/h8-10,12-13H,6-7,11H2,1-5H3,(H,19,21)/t13-/m0/s1 |
| InChIKey | XJIYISXFXOAVHF-ZDUSSCGKSA-N |
| XLogP | 3.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |