C18H25NO6 — CID 7902728
[2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-(4-acetyl-2-methoxyphenoxy)acetate (PubChem CID 7902728) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is [2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-(4-acetyl-2-methoxyphenoxy)acetate.
| Compound Name | [2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-(4-acetyl-2-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 7902728 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | [2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-(4-acetyl-2-methoxyphenoxy)acetate |
| SMILES | COc1cc(C(C)=O)ccc1OCC(=O)OCC(=O)N[C@H](C)C(C)C |
| InChI | InChI=1S/C18H25NO6/c1-11(2)12(3)19-17(21)9-25-18(22)10-24-15-7-6-14(13(4)20)8-16(15)23-5/h6-8,11-12H,9-10H2,1-5H3,(H,19,21)/t12-/m1/s1 |
| InChIKey | DKEJEFOJLYDDIX-GFCCVEGCSA-N |
| XLogP | 1.98 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |