C21H22BrNO6 — CID 55327209
[2-[1-(4-bromophenyl)ethylamino]-2-oxoethyl] 2-(4-acetyl-2-methoxyphenoxy)acetate (PubChem CID 55327209) has the molecular formula C21H22BrNO6 and a molecular weight of 464.31 g/mol. Its IUPAC name is [2-[1-(4-bromophenyl)ethylamino]-2-oxoethyl] 2-(4-acetyl-2-methoxyphenoxy)acetate.
| Compound Name | [2-[1-(4-bromophenyl)ethylamino]-2-oxoethyl] 2-(4-acetyl-2-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 55327209 |
| Molecular Formula | C21H22BrNO6 |
| Molecular Weight | 464.31 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | [2-[1-(4-bromophenyl)ethylamino]-2-oxoethyl] 2-(4-acetyl-2-methoxyphenoxy)acetate |
| SMILES | COc1cc(C(C)=O)ccc1OCC(=O)OCC(=O)NC(C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H22BrNO6/c1-13(15-4-7-17(22)8-5-15)23-20(25)11-29-21(26)12-28-18-9-6-16(14(2)24)10-19(18)27-3/h4-10,13H,11-12H2,1-3H3,(H,23,25) |
| InChIKey | QASCENHCVQPKDQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |