C25H31NO6 — CID 55746116
2-(4-acetyl-2-methoxyphenoxy)-N-[1-(4-cyclopentyloxy-3-methoxyphenyl)ethyl]acetamide (PubChem CID 55746116) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is 2-(4-acetyl-2-methoxyphenoxy)-N-[1-(4-cyclopentyloxy-3-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(4-acetyl-2-methoxyphenoxy)-N-[1-(4-cyclopentyloxy-3-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 55746116 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 2-(4-acetyl-2-methoxyphenoxy)-N-[1-(4-cyclopentyloxy-3-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1cc(C(C)=O)ccc1OCC(=O)NC(C)c1ccc(OC2CCCC2)c(OC)c1 |
| InChI | InChI=1S/C25H31NO6/c1-16(18-9-12-22(24(13-18)30-4)32-20-7-5-6-8-20)26-25(28)15-31-21-11-10-19(17(2)27)14-23(21)29-3/h9-14,16,20H,5-8,15H2,1-4H3,(H,26,28) |
| InChIKey | WOAJYYPVDJIDRR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |