C16H21NO4 — CID 8808309
2-(4-acetyl-2-methoxyphenoxy)-N-[(1R)-1-cyclopropylethyl]acetamide (PubChem CID 8808309) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-(4-acetyl-2-methoxyphenoxy)-N-[(1R)-1-cyclopropylethyl]acetamide.
| Compound Name | 2-(4-acetyl-2-methoxyphenoxy)-N-[(1R)-1-cyclopropylethyl]acetamide |
|---|---|
| PubChem CID | 8808309 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-(4-acetyl-2-methoxyphenoxy)-N-[(1R)-1-cyclopropylethyl]acetamide |
| SMILES | COc1cc(C(C)=O)ccc1OCC(=O)N[C@H](C)C1CC1 |
| InChI | InChI=1S/C16H21NO4/c1-10(12-4-5-12)17-16(19)9-21-14-7-6-13(11(2)18)8-15(14)20-3/h6-8,10,12H,4-5,9H2,1-3H3,(H,17,19)/t10-/m1/s1 |
| InChIKey | DTQBLALDRFELOE-SNVBAGLBSA-N |
| XLogP | 2.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |