C18H25N3O4 — CID 7203614
2-(4-acetamidophenoxy)-N-[[(1R,2S)-2-methylcyclohexyl]carbamoyl]acetamide (PubChem CID 7203614) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-(4-acetamidophenoxy)-N-[[(1R,2S)-2-methylcyclohexyl]carbamoyl]acetamide.
| Compound Name | 2-(4-acetamidophenoxy)-N-[[(1R,2S)-2-methylcyclohexyl]carbamoyl]acetamide |
|---|---|
| PubChem CID | 7203614 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 2-(4-acetamidophenoxy)-N-[[(1R,2S)-2-methylcyclohexyl]carbamoyl]acetamide |
| SMILES | CC(=O)Nc1ccc(OCC(=O)NC(=O)N[C@@H]2CCCC[C@@H]2C)cc1 |
| InChI | InChI=1S/C18H25N3O4/c1-12-5-3-4-6-16(12)20-18(24)21-17(23)11-25-15-9-7-14(8-10-15)19-13(2)22/h7-10,12,16H,3-6,11H2,1-2H3,(H,19,22)(H2,20,21,23,24)/t12-,16+/m0/s1 |
| InChIKey | ANXGNEVYPCNSSA-BLLLJJGKSA-N |
| XLogP | 2.43 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |