C20H27NO5 — CID 5135903
[2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 3-(2,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 5135903) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 3-(2,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 3-(2,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 5135903 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 3-(2,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(OC)c(C=CC(=O)OCC(=O)NC2CCCCC2C)c1 |
| InChI | InChI=1S/C20H27NO5/c1-14-6-4-5-7-17(14)21-19(22)13-26-20(23)11-8-15-12-16(24-2)9-10-18(15)25-3/h8-12,14,17H,4-7,13H2,1-3H3,(H,21,22) |
| InChIKey | GRXCSHXMCVAZRP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|