C21H28N2O6 — CID 7966272
[2-[[(1R,2R)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 7966272) has the molecular formula C21H28N2O6 and a molecular weight of 404.46 g/mol. Its IUPAC name is [2-[[(1R,2R)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-[[(1R,2R)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7966272 |
| Molecular Formula | C21H28N2O6 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | [2-[[(1R,2R)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCC(=O)NC(=O)N[C@@H]2CCCC[C@H]2C)cc1OC |
| InChI | InChI=1S/C21H28N2O6/c1-14-6-4-5-7-16(14)22-21(26)23-19(24)13-29-20(25)11-9-15-8-10-17(27-2)18(12-15)28-3/h8-12,14,16H,4-7,13H2,1-3H3,(H2,22,23,24,26)/b11-9+/t14-,16-/m1/s1 |
| InChIKey | YOVKUBMKZYBEIV-AVWWHXKWSA-N |
| XLogP | 2.66 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|