C21H26F2N2O6 — CID 41167470
[2-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 41167470) has the molecular formula C21H26F2N2O6 and a molecular weight of 440.44 g/mol. Its IUPAC name is [2-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | [2-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 41167470 |
| Molecular Formula | C21H26F2N2O6 |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | [2-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)NC(=O)N[C@@H]2CCCC[C@@H]2C)ccc1OC(F)F |
| InChI | InChI=1S/C21H26F2N2O6/c1-13-5-3-4-6-15(13)24-21(28)25-18(26)12-30-19(27)10-8-14-7-9-16(31-20(22)23)17(11-14)29-2/h7-11,13,15,20H,3-6,12H2,1-2H3,(H2,24,25,26,28)/b10-8+/t13-,15+/m0/s1 |
| InChIKey | AKJLGGGJKMZQPE-XMTZHVTGSA-N |
| XLogP | 3.26 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|