C20H23F2NO6 — CID 55306530
[2-(cyclohexanecarbonylamino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 55306530) has the molecular formula C20H23F2NO6 and a molecular weight of 411.40 g/mol. Its IUPAC name is [2-(cyclohexanecarbonylamino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | [2-(cyclohexanecarbonylamino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 55306530 |
| Molecular Formula | C20H23F2NO6 |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | [2-(cyclohexanecarbonylamino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)NC(=O)C2CCCCC2)ccc1OC(F)F |
| InChI | InChI=1S/C20H23F2NO6/c1-27-16-11-13(7-9-15(16)29-20(21)22)8-10-18(25)28-12-17(24)23-19(26)14-5-3-2-4-6-14/h7-11,14,20H,2-6,12H2,1H3,(H,23,24,26)/b10-8+ |
| InChIKey | GEPYWMWVPGHQQR-CSKARUKUSA-N |
| XLogP | 3.08 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|