C20H24F2N2O6 — CID 24687592
[2-(cyclohexylcarbamoylamino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 24687592) has the molecular formula C20H24F2N2O6 and a molecular weight of 426.42 g/mol. Its IUPAC name is [2-(cyclohexylcarbamoylamino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 24687592 |
| Molecular Formula | C20H24F2N2O6 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)NC(=O)NC2CCCCC2)ccc1OC(F)F |
| InChI | InChI=1S/C20H24F2N2O6/c1-28-16-11-13(7-9-15(16)30-19(21)22)8-10-18(26)29-12-17(25)24-20(27)23-14-5-3-2-4-6-14/h7-11,14,19H,2-6,12H2,1H3,(H2,23,24,25,27)/b10-8+ |
| InChIKey | VQWUEWPLWBAJBO-CSKARUKUSA-N |
| XLogP | 3.01 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|