C18H23F2NO5 — CID 2601398
[2-oxo-2-(pentan-3-ylamino)ethyl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 2601398) has the molecular formula C18H23F2NO5 and a molecular weight of 371.38 g/mol. Its IUPAC name is [2-oxo-2-(pentan-3-ylamino)ethyl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | [2-oxo-2-(pentan-3-ylamino)ethyl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 2601398 |
| Molecular Formula | C18H23F2NO5 |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | [2-oxo-2-(pentan-3-ylamino)ethyl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | CCC(CC)NC(=O)COC(=O)/C=C/c1ccc(OC(F)F)c(OC)c1 |
| InChI | InChI=1S/C18H23F2NO5/c1-4-13(5-2)21-16(22)11-25-17(23)9-7-12-6-8-14(26-18(19)20)15(10-12)24-3/h6-10,13,18H,4-5,11H2,1-3H3,(H,21,22)/b9-7+ |
| InChIKey | NHHROQQLLJYPSR-VQHVLOKHSA-N |
| XLogP | 3.16 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|