C21H19F2NO6 — CID 2125651
[2-(2-acetylanilino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 2125651) has the molecular formula C21H19F2NO6 and a molecular weight of 419.38 g/mol. Its IUPAC name is [2-(2-acetylanilino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | [2-(2-acetylanilino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 2125651 |
| Molecular Formula | C21H19F2NO6 |
| Molecular Weight | 419.38 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | [2-(2-acetylanilino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)Nc2ccccc2C(C)=O)ccc1OC(F)F |
| InChI | InChI=1S/C21H19F2NO6/c1-13(25)15-5-3-4-6-16(15)24-19(26)12-29-20(27)10-8-14-7-9-17(30-21(22)23)18(11-14)28-2/h3-11,21H,12H2,1-2H3,(H,24,26)/b10-8+ |
| InChIKey | WTBPSVOQVUVUGY-CSKARUKUSA-N |
| XLogP | 3.69 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|