C21H21F2NO5 — CID 7726739
[2-(2,4-difluoroanilino)-2-oxoethyl] (E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate (PubChem CID 7726739) has the molecular formula C21H21F2NO5 and a molecular weight of 405.40 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-2-oxoethyl] (E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate.
| Compound Name | [2-(2,4-difluoroanilino)-2-oxoethyl] (E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7726739 |
| Molecular Formula | C21H21F2NO5 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | [2-(2,4-difluoroanilino)-2-oxoethyl] (E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)Nc2ccc(F)cc2F)ccc1OC(C)C |
| InChI | InChI=1S/C21H21F2NO5/c1-13(2)29-18-8-4-14(10-19(18)27-3)5-9-21(26)28-12-20(25)24-17-7-6-15(22)11-16(17)23/h4-11,13H,12H2,1-3H3,(H,24,25)/b9-5+ |
| InChIKey | NBYQPDNZKBQWGA-WEVVVXLNSA-N |
| XLogP | 3.96 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|