C21H22ClNO5 — CID 7726788
[2-(3-chloroanilino)-2-oxoethyl] (E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate (PubChem CID 7726788) has the molecular formula C21H22ClNO5 and a molecular weight of 403.86 g/mol. Its IUPAC name is [2-(3-chloroanilino)-2-oxoethyl] (E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate.
| Compound Name | [2-(3-chloroanilino)-2-oxoethyl] (E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7726788 |
| Molecular Formula | C21H22ClNO5 |
| Molecular Weight | 403.86 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | [2-(3-chloroanilino)-2-oxoethyl] (E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)Nc2cccc(Cl)c2)ccc1OC(C)C |
| InChI | InChI=1S/C21H22ClNO5/c1-14(2)28-18-9-7-15(11-19(18)26-3)8-10-21(25)27-13-20(24)23-17-6-4-5-16(22)12-17/h4-12,14H,13H2,1-3H3,(H,23,24)/b10-8+ |
| InChIKey | LSCXYBHOYBXKJQ-CSKARUKUSA-N |
| XLogP | 4.33 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.86 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|