C21H27NO4 — CID 7700608
N-[(1R,2R)-2-methylcyclohexyl]-2-(2-oxo-4-propan-2-ylchromen-7-yl)oxyacetamide (PubChem CID 7700608) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is N-[(1R,2R)-2-methylcyclohexyl]-2-(2-oxo-4-propan-2-ylchromen-7-yl)oxyacetamide.
| Compound Name | N-[(1R,2R)-2-methylcyclohexyl]-2-(2-oxo-4-propan-2-ylchromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 7700608 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | N-[(1R,2R)-2-methylcyclohexyl]-2-(2-oxo-4-propan-2-ylchromen-7-yl)oxyacetamide |
| SMILES | CC(C)c1cc(=O)oc2cc(OCC(=O)N[C@@H]3CCCC[C@H]3C)ccc12 |
| InChI | InChI=1S/C21H27NO4/c1-13(2)17-11-21(24)26-19-10-15(8-9-16(17)19)25-12-20(23)22-18-7-5-4-6-14(18)3/h8-11,13-14,18H,4-7,12H2,1-3H3,(H,22,23)/t14-,18-/m1/s1 |
| InChIKey | RBWLNIBFAJRBDR-RDTXWAMCSA-N |
| XLogP | 3.99 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|