C21H23NO3 — CID 7916392
2-dibenzofuran-2-yloxy-N-[(1S,2S)-2-methylcyclohexyl]acetamide (PubChem CID 7916392) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-dibenzofuran-2-yloxy-N-[(1S,2S)-2-methylcyclohexyl]acetamide.
| Compound Name | 2-dibenzofuran-2-yloxy-N-[(1S,2S)-2-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 7916392 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 2-dibenzofuran-2-yloxy-N-[(1S,2S)-2-methylcyclohexyl]acetamide |
| SMILES | C[C@H]1CCCC[C@@H]1NC(=O)COc1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C21H23NO3/c1-14-6-2-4-8-18(14)22-21(23)13-24-15-10-11-20-17(12-15)16-7-3-5-9-19(16)25-20/h3,5,7,9-12,14,18H,2,4,6,8,13H2,1H3,(H,22,23)/t14-,18-/m0/s1 |
| InChIKey | BHDCZEKLGADURW-KSSFIOAISA-N |
| XLogP | 4.66 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |