C15H20ClNO2 — CID 2632990
2-(3-chlorophenoxy)-N-[(1R,2R)-2-methylcyclohexyl]acetamide (PubChem CID 2632990) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-[(1R,2R)-2-methylcyclohexyl]acetamide.
| Compound Name | 2-(3-chlorophenoxy)-N-[(1R,2R)-2-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 2632990 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-[(1R,2R)-2-methylcyclohexyl]acetamide |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H20ClNO2/c1-11-5-2-3-8-14(11)17-15(18)10-19-13-7-4-6-12(16)9-13/h4,6-7,9,11,14H,2-3,5,8,10H2,1H3,(H,17,18)/t11-,14-/m1/s1 |
| InChIKey | LWXNZQFILNEAFE-BXUZGUMPSA-N |
| XLogP | 3.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |