C16H20F3NO2 — CID 8024431
N-[(1R,2R)-2-methylcyclohexyl]-2-[3-(trifluoromethyl)phenoxy]acetamide (PubChem CID 8024431) has the molecular formula C16H20F3NO2 and a molecular weight of 315.33 g/mol. Its IUPAC name is N-[(1R,2R)-2-methylcyclohexyl]-2-[3-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-[(1R,2R)-2-methylcyclohexyl]-2-[3-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 8024431 |
| Molecular Formula | C16H20F3NO2 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-[(1R,2R)-2-methylcyclohexyl]-2-[3-(trifluoromethyl)phenoxy]acetamide |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H20F3NO2/c1-11-5-2-3-8-14(11)20-15(21)10-22-13-7-4-6-12(9-13)16(17,18)19/h4,6-7,9,11,14H,2-3,5,8,10H2,1H3,(H,20,21)/t11-,14-/m1/s1 |
| InChIKey | IJHCLLOUUQDGTM-BXUZGUMPSA-N |
| XLogP | 3.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |