C16H18F3NO2 — CID 133190091
N-(2-bicyclo[2.2.1]heptanyl)-2-[3-(trifluoromethyl)phenoxy]acetamide (PubChem CID 133190091) has the molecular formula C16H18F3NO2 and a molecular weight of 313.32 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanyl)-2-[3-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-(2-bicyclo[2.2.1]heptanyl)-2-[3-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 133190091 |
| Molecular Formula | C16H18F3NO2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanyl)-2-[3-(trifluoromethyl)phenoxy]acetamide |
| SMILES | O=C(COc1cccc(C(F)(F)F)c1)NC1CC2CCC1C2 |
| InChI | InChI=1S/C16H18F3NO2/c17-16(18,19)12-2-1-3-13(8-12)22-9-15(21)20-14-7-10-4-5-11(14)6-10/h1-3,8,10-11,14H,4-7,9H2,(H,20,21) |
| InChIKey | NTUPIDBSZLTFNM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |