C20H16BrFO5 — CID 29394573
(7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(4-bromo-2-fluorophenoxy)acetate (PubChem CID 29394573) has the molecular formula C20H16BrFO5 and a molecular weight of 435.25 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(4-bromo-2-fluorophenoxy)acetate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(4-bromo-2-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 29394573 |
| Molecular Formula | C20H16BrFO5 |
| Molecular Weight | 435.25 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(4-bromo-2-fluorophenoxy)acetate |
| SMILES | Cc1ccc2c(COC(=O)COc3ccc(Br)cc3F)cc(=O)oc2c1C |
| InChI | InChI=1S/C20H16BrFO5/c1-11-3-5-15-13(7-18(23)27-20(15)12(11)2)9-26-19(24)10-25-17-6-4-14(21)8-16(17)22/h3-8H,9-10H2,1-2H3 |
| InChIKey | YTQNCCDAZZEWSQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.25 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|