C21H18FNO5 — CID 8662659
(7,8-dimethyl-2-oxochromen-4-yl)methyl 2-[(3-fluorobenzoyl)amino]acetate (PubChem CID 8662659) has the molecular formula C21H18FNO5 and a molecular weight of 383.38 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-[(3-fluorobenzoyl)amino]acetate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-[(3-fluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 8662659 |
| Molecular Formula | C21H18FNO5 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-[(3-fluorobenzoyl)amino]acetate |
| SMILES | Cc1ccc2c(COC(=O)CNC(=O)c3cccc(F)c3)cc(=O)oc2c1C |
| InChI | InChI=1S/C21H18FNO5/c1-12-6-7-17-15(9-18(24)28-20(17)13(12)2)11-27-19(25)10-23-21(26)14-4-3-5-16(22)8-14/h3-9H,10-11H2,1-2H3,(H,23,26) |
| InChIKey | POGBIFJDPFJVPK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|