C23H22O6 — CID 8534826
(7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(5-acetyl-2-methoxyphenyl)acetate (PubChem CID 8534826) has the molecular formula C23H22O6 and a molecular weight of 394.42 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(5-acetyl-2-methoxyphenyl)acetate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(5-acetyl-2-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 8534826 |
| Molecular Formula | C23H22O6 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(5-acetyl-2-methoxyphenyl)acetate |
| SMILES | COc1ccc(C(C)=O)cc1CC(=O)OCc1cc(=O)oc2c(C)c(C)ccc12 |
| InChI | InChI=1S/C23H22O6/c1-13-5-7-19-18(11-22(26)29-23(19)14(13)2)12-28-21(25)10-17-9-16(15(3)24)6-8-20(17)27-4/h5-9,11H,10,12H2,1-4H3 |
| InChIKey | KOVZUEDOFOCANG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|