C20H15NO4 — CID 4017961
(7,8-dimethyl-2-oxochromen-4-yl)methyl 4-cyanobenzoate (PubChem CID 4017961) has the molecular formula C20H15NO4 and a molecular weight of 333.34 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-cyanobenzoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-cyanobenzoate |
|---|---|
| PubChem CID | 4017961 |
| Molecular Formula | C20H15NO4 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-cyanobenzoate |
| SMILES | Cc1ccc2c(COC(=O)c3ccc(C#N)cc3)cc(=O)oc2c1C |
| InChI | InChI=1S/C20H15NO4/c1-12-3-8-17-16(9-18(22)25-19(17)13(12)2)11-24-20(23)15-6-4-14(10-21)5-7-15/h3-9H,11H2,1-2H3 |
| InChIKey | CYWSAXIQZXNCKG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 80.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|