C21H20O6S — CID 7849531
(7,8-dimethyl-2-oxochromen-4-yl)methyl 2-methyl-5-methylsulfonylbenzoate (PubChem CID 7849531) has the molecular formula C21H20O6S and a molecular weight of 400.45 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-methyl-5-methylsulfonylbenzoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-methyl-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 7849531 |
| Molecular Formula | C21H20O6S |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-methyl-5-methylsulfonylbenzoate |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1C(=O)OCc1cc(=O)oc2c(C)c(C)ccc12 |
| InChI | InChI=1S/C21H20O6S/c1-12-6-8-17-15(9-19(22)27-20(17)14(12)3)11-26-21(23)18-10-16(28(4,24)25)7-5-13(18)2/h5-10H,11H2,1-4H3 |
| InChIKey | DQMPNJOUWWOTOV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 90.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|