C19H20N2O4 — CID 56808591
(7,8-dimethyl-2-oxochromen-4-yl)methyl 5-propan-2-yl-1H-pyrazole-4-carboxylate (PubChem CID 56808591) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 5-propan-2-yl-1H-pyrazole-4-carboxylate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 5-propan-2-yl-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 56808591 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 5-propan-2-yl-1H-pyrazole-4-carboxylate |
| SMILES | Cc1ccc2c(COC(=O)c3cn[nH]c3C(C)C)cc(=O)oc2c1C |
| InChI | InChI=1S/C19H20N2O4/c1-10(2)17-15(8-20-21-17)19(23)24-9-13-7-16(22)25-18-12(4)11(3)5-6-14(13)18/h5-8,10H,9H2,1-4H3,(H,20,21) |
| InChIKey | ASPJYGJDSANVCH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|